C27H24Cl2N4O3 — CID 177374701
N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-ethyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide (PubChem CID 177374701) has the molecular formula C27H24Cl2N4O3 and a molecular weight of 523.42 g/mol. Its IUPAC name is N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-ethyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-ethyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 177374701 |
| Molecular Formula | C27H24Cl2N4O3 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-ethyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc2c(CC)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C27H24Cl2N4O3/c1-5-17-16-12-23(32-18-9-7-8-10-19(18)33-24(34)6-2)30-14-15(16)11-20(31-17)25-26(28)21(35-3)13-22(36-4)27(25)29/h6-14H,2,5H2,1,3-4H3,(H,30,32)(H,33,34) |
| InChIKey | GTIAXDZIHRRGIF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|