C28H24Cl2N4O3 — CID 177374702
N-[2-[[5-cyclopropyl-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide (PubChem CID 177374702) has the molecular formula C28H24Cl2N4O3 and a molecular weight of 535.43 g/mol. Its IUPAC name is N-[2-[[5-cyclopropyl-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-cyclopropyl-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 177374702 |
| Molecular Formula | C28H24Cl2N4O3 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | N-[2-[[5-cyclopropyl-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc2c(C3CC3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C28H24Cl2N4O3/c1-4-24(35)33-19-8-6-5-7-18(19)32-23-12-17-16(14-31-23)11-20(34-28(17)15-9-10-15)25-26(29)21(36-2)13-22(37-3)27(25)30/h4-8,11-15H,1,9-10H2,2-3H3,(H,31,32)(H,33,35) |
| InChIKey | QXWOKLIZODHOMT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|