C31H24Cl2N4O3 — CID 177374703
N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-phenyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide (PubChem CID 177374703) has the molecular formula C31H24Cl2N4O3 and a molecular weight of 571.46 g/mol. Its IUPAC name is N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-phenyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-phenyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 177374703 |
| Molecular Formula | C31H24Cl2N4O3 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-phenyl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc2c(-c3ccccc3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C31H24Cl2N4O3/c1-4-27(38)36-22-13-9-8-12-21(22)35-26-15-20-19(17-34-26)14-23(37-31(20)18-10-6-5-7-11-18)28-29(32)24(39-2)16-25(40-3)30(28)33/h4-17H,1H2,2-3H3,(H,34,35)(H,36,38) |
| InChIKey | PHROOOQUMUVQDS-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|