C30H23Cl2N5O3 — CID 177374704
N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-pyridin-3-yl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide (PubChem CID 177374704) has the molecular formula C30H23Cl2N5O3 and a molecular weight of 572.45 g/mol. Its IUPAC name is N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-pyridin-3-yl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-pyridin-3-yl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 177374704 |
| Molecular Formula | C30H23Cl2N5O3 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-pyridin-3-yl-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc2c(-c3cccnc3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C30H23Cl2N5O3/c1-4-26(38)36-21-10-6-5-9-20(21)35-25-13-19-18(16-34-25)12-22(37-30(19)17-8-7-11-33-15-17)27-28(31)23(39-2)14-24(40-3)29(27)32/h4-16H,1H2,2-3H3,(H,34,35)(H,36,38) |
| InChIKey | BXWBKWVCJFLYCC-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|