C29H24Cl2N6O3 — CID 177374705
N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(1-methylpyrazol-4-yl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide (PubChem CID 177374705) has the molecular formula C29H24Cl2N6O3 and a molecular weight of 575.46 g/mol. Its IUPAC name is N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(1-methylpyrazol-4-yl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(1-methylpyrazol-4-yl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 177374705 |
| Molecular Formula | C29H24Cl2N6O3 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(1-methylpyrazol-4-yl)-2,6-naphthyridin-3-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc2c(-c3cnn(C)c3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C29H24Cl2N6O3/c1-5-25(38)35-20-9-7-6-8-19(20)34-24-11-18-16(13-32-24)10-21(36-29(18)17-14-33-37(2)15-17)26-27(30)22(39-3)12-23(40-4)28(26)31/h5-15H,1H2,2-4H3,(H,32,34)(H,35,38) |
| InChIKey | AHYHQMHWJOORRK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|