C39H41N9O7 — CID 177374761
N-[4-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoyl]piperazin-1-yl]-2-methoxyphenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide (PubChem CID 177374761) has the molecular formula C39H41N9O7 and a molecular weight of 747.81 g/mol. Its IUPAC name is N-[4-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoyl]piperazin-1-yl]-2-methoxyphenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide.
| Compound Name | N-[4-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoyl]piperazin-1-yl]-2-methoxyphenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177374761 |
| Molecular Formula | C39H41N9O7 |
| Molecular Weight | 747.81 g/mol |
| Exact Mass | 747.31 |
| IUPAC Name | N-[4-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoyl]piperazin-1-yl]-2-methoxyphenyl]-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide |
| SMILES | COc1cc(N2CCN(C(=O)CCCCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)ccc1NC(=O)c1cccc(-c2ccn[nH]2)n1 |
| InChI | InChI=1S/C39H41N9O7/c1-55-32-23-24(12-13-28(32)43-36(51)30-10-6-8-26(42-30)27-16-18-41-45-27)46-19-21-47(22-20-46)34(50)11-3-2-4-17-40-29-9-5-7-25-35(29)39(54)48(38(25)53)31-14-15-33(49)44-37(31)52/h5-10,12-13,16,18,23,31,40H,2-4,11,14-15,17,19-22H2,1H3,(H,41,45)(H,43,51)(H,44,49,52) |
| InChIKey | SEXLPVSXRRLESN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 199.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|