C21H15Cl2F2N9O2S — CID 177375212
6-[(2-amino-5-chloro-1,3-benzothiazol-6-yl)amino]-1-[(3-chloro-4,5-difluorophenyl)methyl]-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 177375212) has the molecular formula C21H15Cl2F2N9O2S and a molecular weight of 566.38 g/mol. Its IUPAC name is 6-[(2-amino-5-chloro-1,3-benzothiazol-6-yl)amino]-1-[(3-chloro-4,5-difluorophenyl)methyl]-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(2-amino-5-chloro-1,3-benzothiazol-6-yl)amino]-1-[(3-chloro-4,5-difluorophenyl)methyl]-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 177375212 |
| Molecular Formula | C21H15Cl2F2N9O2S |
| Molecular Weight | 566.38 g/mol |
| Exact Mass | 565.04 |
| IUPAC Name | 6-[(2-amino-5-chloro-1,3-benzothiazol-6-yl)amino]-1-[(3-chloro-4,5-difluorophenyl)methyl]-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | Cn1cnc(Cn2c(=O)nc(Nc3cc4sc(N)nc4cc3Cl)n(Cc3cc(F)c(F)c(Cl)c3)c2=O)n1 |
| InChI | InChI=1S/C21H15Cl2F2N9O2S/c1-32-8-27-16(31-32)7-34-20(35)30-19(29-13-5-15-14(4-10(13)22)28-18(26)37-15)33(21(34)36)6-9-2-11(23)17(25)12(24)3-9/h2-5,8H,6-7H2,1H3,(H2,26,28)(H,29,30,35) |
| InChIKey | BBPAZJBYZLACQU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|