C23H17Cl2F2N9O3S — CID 177375215
N-[5-chloro-6-[[1-[(3-chloro-4,5-difluorophenyl)methyl]-5-[(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]-1,3-benzothiazol-2-yl]acetamide (PubChem CID 177375215) has the molecular formula C23H17Cl2F2N9O3S and a molecular weight of 608.42 g/mol. Its IUPAC name is N-[5-chloro-6-[[1-[(3-chloro-4,5-difluorophenyl)methyl]-5-[(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[5-chloro-6-[[1-[(3-chloro-4,5-difluorophenyl)methyl]-5-[(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 177375215 |
| Molecular Formula | C23H17Cl2F2N9O3S |
| Molecular Weight | 608.42 g/mol |
| Exact Mass | 607.05 |
| IUPAC Name | N-[5-chloro-6-[[1-[(3-chloro-4,5-difluorophenyl)methyl]-5-[(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2cc(Cl)c(Nc3nc(=O)n(Cc4ncn(C)n4)c(=O)n3Cc3cc(F)c(F)c(Cl)c3)cc2s1 |
| InChI | InChI=1S/C23H17Cl2F2N9O3S/c1-10(37)29-21-31-16-5-12(24)15(6-17(16)40-21)30-20-32-22(38)36(8-18-28-9-34(2)33-18)23(39)35(20)7-11-3-13(25)19(27)14(26)4-11/h3-6,9H,7-8H2,1-2H3,(H,29,31,37)(H,30,32,38) |
| InChIKey | PRHXADRFGATOPS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|