About [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid
[(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid (PubChem CID 177375813) has the molecular formula C14H8BrF4O3P
and a molecular weight of 411.09 g/mol. Its IUPAC name is [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid.
Molecular Properties
| Compound Name | [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid |
| PubChem CID | 177375813 |
| Molecular Formula | C14H8BrF4O3P |
| Molecular Weight | 411.09 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc2c(c1)C(F)(F)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C14H8BrF4O3P/c15-8-2-4-10-9-3-1-7(14(18,19)23(20,21)22)5-11(9)13(16,17)12(10)6-8/h1-6H,(H2,20,21,22) |
| InChIKey | ZXSZNVDQSRRNFG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.09 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid?
The IUPAC name of [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid (CID 177375813) is [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid.
What is the SMILES notation for [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid?
The canonical SMILES for [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid is O=P(O)(O)C(F)(F)c1ccc2c(c1)C(F)(F)c1cc(Br)ccc1-2.
What is the InChIKey of [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid?
The InChIKey is ZXSZNVDQSRRNFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrF4O3P/c15-8-2-4-10-9-3-1-7(14(18,19)23(20,21)22)5-11(9)13(16,17)12(10)6-8/h1-6H,(H2,20,21,22).
What are the key properties of [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid?
[(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid has a molecular weight of 411.09 g/mol, XLogP of 4.80, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(7-bromo-9,9-difluorofluoren-2-yl)-difluoromethyl]phosphonic acid is sourced from PubChem (CID 177375813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).