C21H18N4O5S — CID 177375947
6-[[4-[(2,4-dihydroxyphenyl)methylamino]-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-hydroxypyran-2-one (PubChem CID 177375947) has the molecular formula C21H18N4O5S and a molecular weight of 438.47 g/mol. Its IUPAC name is 6-[[4-[(2,4-dihydroxyphenyl)methylamino]-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-hydroxypyran-2-one.
| Compound Name | 6-[[4-[(2,4-dihydroxyphenyl)methylamino]-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-hydroxypyran-2-one |
|---|---|
| PubChem CID | 177375947 |
| Molecular Formula | C21H18N4O5S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 6-[[4-[(2,4-dihydroxyphenyl)methylamino]-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-hydroxypyran-2-one |
| SMILES | O=c1cc(O)cc(CSc2nnc(-c3ccccc3)n2NCc2ccc(O)cc2O)o1 |
| InChI | InChI=1S/C21H18N4O5S/c26-15-7-6-14(18(28)9-15)11-22-25-20(13-4-2-1-3-5-13)23-24-21(25)31-12-17-8-16(27)10-19(29)30-17/h1-10,22,26-28H,11-12H2 |
| InChIKey | PWEILXQUJZJURV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|