C31H33N7O5S — CID 177376035
2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-N-[7-oxo-7-(1,3-thiazol-2-ylamino)heptyl]-7H-purine-6-carboxamide (PubChem CID 177376035) has the molecular formula C31H33N7O5S and a molecular weight of 615.72 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-N-[7-oxo-7-(1,3-thiazol-2-ylamino)heptyl]-7H-purine-6-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-N-[7-oxo-7-(1,3-thiazol-2-ylamino)heptyl]-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 177376035 |
| Molecular Formula | C31H33N7O5S |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | 2-(4-ethoxyphenyl)-9-(2-methoxyphenyl)-8-oxo-N-[7-oxo-7-(1,3-thiazol-2-ylamino)heptyl]-7H-purine-6-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(=O)NCCCCCCC(=O)Nc3nccs3)c3[nH]c(=O)n(-c4ccccc4OC)c3n2)cc1 |
| InChI | InChI=1S/C31H33N7O5S/c1-3-43-21-15-13-20(14-16-21)27-35-26(25-28(37-27)38(31(41)36-25)22-10-7-8-11-23(22)42-2)29(40)32-17-9-5-4-6-12-24(39)34-30-33-18-19-44-30/h7-8,10-11,13-16,18-19H,3-6,9,12,17H2,1-2H3,(H,32,40)(H,36,41)(H,33,34,39) |
| InChIKey | BOZNEIRMSXJLIY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|