C17H25NO2 — CID 177376067
3-cyclohexyl-6,8-dimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 177376067) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-cyclohexyl-6,8-dimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-cyclohexyl-6,8-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 177376067 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-cyclohexyl-6,8-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(c(OC)c1)CNC(C1CCCCC1)C2 |
| InChI | InChI=1S/C17H25NO2/c1-19-14-8-13-9-16(12-6-4-3-5-7-12)18-11-15(13)17(10-14)20-2/h8,10,12,16,18H,3-7,9,11H2,1-2H3 |
| InChIKey | XPHSQPAWPLENIV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |