About ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate
ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate (PubChem CID 177376153) has the molecular formula C39H40N2O3
and a molecular weight of 584.76 g/mol. Its IUPAC name is ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate.
Molecular Properties
| Compound Name | ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate |
| PubChem CID | 177376153 |
| Molecular Formula | C39H40N2O3 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cn(CCCCCCNc2ccc(C(=C(C)c3ccccc3)c3ccccc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C39H40N2O3/c1-3-44-39(43)38(42)35-28-41(36-21-13-12-20-34(35)36)27-15-5-4-14-26-40-33-24-22-32(23-25-33)37(31-18-10-7-11-19-31)29(2)30-16-8-6-9-17-30/h6-13,16-25,28,40H,3-5,14-15,26-27H2,1-2H3 |
| InChIKey | RFNLWQZHFXEYES-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate?
The IUPAC name of ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate (CID 177376153) is ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate.
What is the SMILES notation for ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate?
The canonical SMILES for ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate is CCOC(=O)C(=O)c1cn(CCCCCCNc2ccc(C(=C(C)c3ccccc3)c3ccccc3)cc2)c2ccccc12.
What is the InChIKey of ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate?
The InChIKey is RFNLWQZHFXEYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H40N2O3/c1-3-44-39(43)38(42)35-28-41(36-21-13-12-20-34(35)36)27-15-5-4-14-26-40-33-24-22-32(23-25-33)37(31-18-10-7-11-19-31)29(2)30-16-8-6-9-17-30/h6-13,16-25,28,40H,3-5,14-15,26-27H2,1-2H3.
What are the key properties of ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate?
ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate has a molecular weight of 584.76 g/mol, XLogP of 9.04, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-[6-[4-(1,2-diphenylprop-1-enyl)anilino]hexyl]indol-3-yl]-2-oxoacetate is sourced from PubChem (CID 177376153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).