About 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid
2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid (PubChem CID 177376154) has the molecular formula C33H28N2O3
and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid |
| PubChem CID | 177376154 |
| Molecular Formula | C33H28N2O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid |
| SMILES | CC(=C(c1ccccc1)c1ccc(NCCn2cc(C(=O)C(=O)O)c3ccccc32)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H28N2O3/c1-23(24-10-4-2-5-11-24)31(25-12-6-3-7-13-25)26-16-18-27(19-17-26)34-20-21-35-22-29(32(36)33(37)38)28-14-8-9-15-30(28)35/h2-19,22,34H,20-21H2,1H3,(H,37,38) |
| InChIKey | LFAQWZHHAOEPRC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid?
The IUPAC name of 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid (CID 177376154) is 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid.
What is the SMILES notation for 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid?
The canonical SMILES for 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid is CC(=C(c1ccccc1)c1ccc(NCCn2cc(C(=O)C(=O)O)c3ccccc32)cc1)c1ccccc1.
What is the InChIKey of 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid?
The InChIKey is LFAQWZHHAOEPRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H28N2O3/c1-23(24-10-4-2-5-11-24)31(25-12-6-3-7-13-25)26-16-18-27(19-17-26)34-20-21-35-22-29(32(36)33(37)38)28-14-8-9-15-30(28)35/h2-19,22,34H,20-21H2,1H3,(H,37,38).
What are the key properties of 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid?
2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid has a molecular weight of 500.60 g/mol, XLogP of 7.00, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-[4-(1,2-diphenylprop-1-enyl)anilino]ethyl]indol-3-yl]-2-oxoacetic acid is sourced from PubChem (CID 177376154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).