About 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid
2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid (PubChem CID 177376155) has the molecular formula C34H30N2O3
and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid |
| PubChem CID | 177376155 |
| Molecular Formula | C34H30N2O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid |
| SMILES | CC(=C(c1ccccc1)c1ccc(NCCCn2cc(C(=O)C(=O)O)c3ccccc32)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H30N2O3/c1-24(25-11-4-2-5-12-25)32(26-13-6-3-7-14-26)27-17-19-28(20-18-27)35-21-10-22-36-23-30(33(37)34(38)39)29-15-8-9-16-31(29)36/h2-9,11-20,23,35H,10,21-22H2,1H3,(H,38,39) |
| InChIKey | MHGUHPFAWOSMAQ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid?
The IUPAC name of 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid (CID 177376155) is 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid.
What is the SMILES notation for 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid?
The canonical SMILES for 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid is CC(=C(c1ccccc1)c1ccc(NCCCn2cc(C(=O)C(=O)O)c3ccccc32)cc1)c1ccccc1.
What is the InChIKey of 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid?
The InChIKey is MHGUHPFAWOSMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H30N2O3/c1-24(25-11-4-2-5-12-25)32(26-13-6-3-7-14-26)27-17-19-28(20-18-27)35-21-10-22-36-23-30(33(37)34(38)39)29-15-8-9-16-31(29)36/h2-9,11-20,23,35H,10,21-22H2,1H3,(H,38,39).
What are the key properties of 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid?
2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid has a molecular weight of 514.63 g/mol, XLogP of 7.39, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[3-[4-(1,2-diphenylprop-1-enyl)anilino]propyl]indol-3-yl]-2-oxoacetic acid is sourced from PubChem (CID 177376155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).