C35H32N2O3 — CID 177376156
2-[1-[4-[4-(1,2-diphenylprop-1-enyl)anilino]butyl]indol-3-yl]-2-oxoacetic acid (PubChem CID 177376156) has the molecular formula C35H32N2O3 and a molecular weight of 528.65 g/mol. Its IUPAC name is 2-[1-[4-[4-(1,2-diphenylprop-1-enyl)anilino]butyl]indol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[1-[4-[4-(1,2-diphenylprop-1-enyl)anilino]butyl]indol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 177376156 |
| Molecular Formula | C35H32N2O3 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 2-[1-[4-[4-(1,2-diphenylprop-1-enyl)anilino]butyl]indol-3-yl]-2-oxoacetic acid |
| SMILES | CC(=C(c1ccccc1)c1ccc(NCCCCn2cc(C(=O)C(=O)O)c3ccccc32)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H32N2O3/c1-25(26-12-4-2-5-13-26)33(27-14-6-3-7-15-27)28-18-20-29(21-19-28)36-22-10-11-23-37-24-31(34(38)35(39)40)30-16-8-9-17-32(30)37/h2-9,12-21,24,36H,10-11,22-23H2,1H3,(H,39,40) |
| InChIKey | LLZOQWPBWKNHET-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|