C12H9N5O3 — CID 177376169
2-methyl-5-(4-nitrophenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 177376169) has the molecular formula C12H9N5O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-methyl-5-(4-nitrophenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-methyl-5-(4-nitrophenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 177376169 |
| Molecular Formula | C12H9N5O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-methyl-5-(4-nitrophenyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1nc2nc(-c3ccc([N+](=O)[O-])cc3)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C12H9N5O3/c1-7-13-12-14-10(6-11(18)16(12)15-7)8-2-4-9(5-3-8)17(19)20/h2-6H,1H3,(H,13,14,15) |
| InChIKey | OKBDSMWCIPFYKN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|