C29H42O3 — CID 177376300
(5S,10S,13R,14R,17R)-17-[(2R)-5-(2-hydroxy-5-oxocyclopenten-1-yl)pentan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 177376300) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is (5S,10S,13R,14R,17R)-17-[(2R)-5-(2-hydroxy-5-oxocyclopenten-1-yl)pentan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,10S,13R,14R,17R)-17-[(2R)-5-(2-hydroxy-5-oxocyclopenten-1-yl)pentan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 177376300 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | (5S,10S,13R,14R,17R)-17-[(2R)-5-(2-hydroxy-5-oxocyclopenten-1-yl)pentan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H](CCCC1=C(O)CCC1=O)[C@H]1CC[C@H]2C3=CC[C@H]4CC(=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C29H42O3/c1-18(5-4-6-22-26(31)11-12-27(22)32)23-9-10-24-21-8-7-19-17-20(30)13-15-28(19,2)25(21)14-16-29(23,24)3/h8,18-19,23-25,31H,4-7,9-17H2,1-3H3/t18-,19+,23-,24+,25?,28+,29-/m1/s1 |
| InChIKey | LNEZTQUZHNWNLB-UTQUZDRDSA-N |
| XLogP | 7.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|