About 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide
3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide (PubChem CID 177376429) has the molecular formula C22H19N5OS
and a molecular weight of 401.50 g/mol. Its IUPAC name is 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide.
Molecular Properties
| Compound Name | 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide |
| PubChem CID | 177376429 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1cncc(-c2ccc3n[nH]c(C#Cc4cscn4)c3c2)c1 |
| InChI | InChI=1S/C22H19N5OS/c1-14(2)7-22(28)25-18-8-16(10-23-11-18)15-3-5-20-19(9-15)21(27-26-20)6-4-17-12-29-13-24-17/h3,5,8-14H,7H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | YKWBLRFUDQABBG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide?
The IUPAC name of 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide (CID 177376429) is 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide.
What is the SMILES notation for 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide?
The canonical SMILES for 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide is CC(C)CC(=O)Nc1cncc(-c2ccc3n[nH]c(C#Cc4cscn4)c3c2)c1.
What is the InChIKey of 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide?
The InChIKey is YKWBLRFUDQABBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5OS/c1-14(2)7-22(28)25-18-8-16(10-23-11-18)15-3-5-20-19(9-15)21(27-26-20)6-4-17-12-29-13-24-17/h3,5,8-14H,7H2,1-2H3,(H,25,28)(H,26,27).
What are the key properties of 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide?
3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide has a molecular weight of 401.50 g/mol, XLogP of 4.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[5-[3-[2-(1,3-thiazol-4-yl)ethynyl]-2H-indazol-5-yl]-3-pyridinyl]butanamide is sourced from PubChem (CID 177376429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).