About 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide
4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide (PubChem CID 177376555) has the molecular formula C23H18N4O2
and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide |
| PubChem CID | 177376555 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2cn3c(-c4cc5ccccc5o4)cnc3cn2)cc1 |
| InChI | InChI=1S/C23H18N4O2/c1-26(2)23(28)16-9-7-15(8-10-16)18-14-27-19(12-25-22(27)13-24-18)21-11-17-5-3-4-6-20(17)29-21/h3-14H,1-2H3 |
| InChIKey | PYMYZZLESAPEGL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide?
The IUPAC name of 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide (CID 177376555) is 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide.
What is the SMILES notation for 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide?
The canonical SMILES for 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(-c2cn3c(-c4cc5ccccc5o4)cnc3cn2)cc1.
What is the InChIKey of 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide?
The InChIKey is PYMYZZLESAPEGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N4O2/c1-26(2)23(28)16-9-7-15(8-10-16)18-14-27-19(12-25-22(27)13-24-18)21-11-17-5-3-4-6-20(17)29-21/h3-14H,1-2H3.
What are the key properties of 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide?
4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide has a molecular weight of 382.42 g/mol, XLogP of 4.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1-benzofuran-2-yl)imidazo[1,2-a]pyrazin-6-yl]-N,N-dimethylbenzamide is sourced from PubChem (CID 177376555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).