C13H16FN3O4S — CID 177376714
5-(6-fluoro-8-hydroxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 177376714) has the molecular formula C13H16FN3O4S and a molecular weight of 329.35 g/mol. Its IUPAC name is 5-(6-fluoro-8-hydroxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-(6-fluoro-8-hydroxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 177376714 |
| Molecular Formula | C13H16FN3O4S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 5-(6-fluoro-8-hydroxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CN1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2CC1 |
| InChI | InChI=1S/C13H16FN3O4S/c1-16-4-2-8-6-10(18)13(12(14)9(8)3-5-16)17-7-11(19)15-22(17,20)21/h6,18H,2-5,7H2,1H3,(H,15,19) |
| InChIKey | CSZWJINLHGTHRJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |