C14H16F3N3O4S — CID 177376717
5-[3-(2,2-difluoroethyl)-6-fluoro-8-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 177376717) has the molecular formula C14H16F3N3O4S and a molecular weight of 379.36 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-6-fluoro-8-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[3-(2,2-difluoroethyl)-6-fluoro-8-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 177376717 |
| Molecular Formula | C14H16F3N3O4S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-6-fluoro-8-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)CCN(CC(F)F)CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C14H16F3N3O4S/c15-11(16)6-19-3-1-8-5-10(21)14(13(17)9(8)2-4-19)20-7-12(22)18-25(20,23)24/h5,11,21H,1-4,6-7H2,(H,18,22) |
| InChIKey | NHFWJPORIWEHFH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |