C39H42F3N7O6 — CID 177376819
N-[2-[9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]nonyl]-6-(2-hydroxypropan-2-yl)indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 177376819) has the molecular formula C39H42F3N7O6 and a molecular weight of 761.80 g/mol. Its IUPAC name is N-[2-[9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]nonyl]-6-(2-hydroxypropan-2-yl)indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[2-[9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]nonyl]-6-(2-hydroxypropan-2-yl)indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177376819 |
| Molecular Formula | C39H42F3N7O6 |
| Molecular Weight | 761.80 g/mol |
| Exact Mass | 761.31 |
| IUPAC Name | N-[2-[9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]nonyl]-6-(2-hydroxypropan-2-yl)indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CC(C)(O)c1cc2nn(CCCCCCCCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)cc2cc1NC(=O)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C39H42F3N7O6/c1-38(2,55)25-21-28-23(20-29(25)45-34(51)27-14-11-15-31(44-27)39(40,41)42)22-48(47-28)19-9-7-5-3-4-6-8-18-43-26-13-10-12-24-33(26)37(54)49(36(24)53)30-16-17-32(50)46-35(30)52/h10-15,20-22,30,43,55H,3-9,16-19H2,1-2H3,(H,45,51)(H,46,50,52) |
| InChIKey | OXMXTNDWZBEXAL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 175.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.80 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|