C16H28BN3O3 — CID 177377110
[(1R)-1-[(3-cyclohexyl-1-methylpyrazole-5-carbonyl)amino]-3-methylbutyl]boronic acid (PubChem CID 177377110) has the molecular formula C16H28BN3O3 and a molecular weight of 321.23 g/mol. Its IUPAC name is [(1R)-1-[(3-cyclohexyl-1-methylpyrazole-5-carbonyl)amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[(3-cyclohexyl-1-methylpyrazole-5-carbonyl)amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 177377110 |
| Molecular Formula | C16H28BN3O3 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | [(1R)-1-[(3-cyclohexyl-1-methylpyrazole-5-carbonyl)amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1cc(C2CCCCC2)nn1C)B(O)O |
| InChI | InChI=1S/C16H28BN3O3/c1-11(2)9-15(17(22)23)18-16(21)14-10-13(19-20(14)3)12-7-5-4-6-8-12/h10-12,15,22-23H,4-9H2,1-3H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | DOSZXVDPLQJPSQ-HNNXBMFYSA-N |
| XLogP | 1.62 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|