C22H20F2N6O2S — CID 177377535
5-fluoro-N-[(4-fluorophenyl)methyl]-2-[[2-[(N'-methylcarbamimidoyl)amino]-1,3-thiazol-5-yl]methyl]-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 177377535) has the molecular formula C22H20F2N6O2S and a molecular weight of 470.51 g/mol. Its IUPAC name is 5-fluoro-N-[(4-fluorophenyl)methyl]-2-[[2-[(N'-methylcarbamimidoyl)amino]-1,3-thiazol-5-yl]methyl]-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | 5-fluoro-N-[(4-fluorophenyl)methyl]-2-[[2-[(N'-methylcarbamimidoyl)amino]-1,3-thiazol-5-yl]methyl]-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 177377535 |
| Molecular Formula | C22H20F2N6O2S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 5-fluoro-N-[(4-fluorophenyl)methyl]-2-[[2-[(N'-methylcarbamimidoyl)amino]-1,3-thiazol-5-yl]methyl]-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | C/N=C(\N)Nc1ncc(CN2C(=O)c3cc(F)ccc3C2C(=O)NCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C22H20F2N6O2S/c1-26-21(25)29-22-28-10-15(33-22)11-30-18(16-7-6-14(24)8-17(16)20(30)32)19(31)27-9-12-2-4-13(23)5-3-12/h2-8,10,18H,9,11H2,1H3,(H,27,31)(H3,25,26,28,29) |
| InChIKey | NBBBWNYOLQKFCM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|