About N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide
N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 177377629) has the molecular formula C18H21N5OS
and a molecular weight of 355.47 g/mol. Its IUPAC name is N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 177377629 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(CN2CCC(C#Cc3cncc(C)n3)CC2)s1 |
| InChI | InChI=1S/C18H21N5OS/c1-13-9-19-10-16(21-13)4-3-15-5-7-23(8-6-15)12-17-11-20-18(25-17)22-14(2)24/h9-11,15H,5-8,12H2,1-2H3,(H,20,22,24) |
| InChIKey | MZGQVPHOULMDNH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide (CID 177377629) is N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1ncc(CN2CCC(C#Cc3cncc(C)n3)CC2)s1.
What is the InChIKey of N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide?
The InChIKey is MZGQVPHOULMDNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5OS/c1-13-9-19-10-16(21-13)4-3-15-5-7-23(8-6-15)12-17-11-20-18(25-17)22-14(2)24/h9-11,15H,5-8,12H2,1-2H3,(H,20,22,24).
What are the key properties of N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide?
N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide has a molecular weight of 355.47 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[[4-[2-(6-methylpyrazin-2-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 177377629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).