C22H26N4OS — CID 177377664
N-[5-[[4-[2-(1,2,3,4-tetrahydroquinolin-7-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 177377664) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[5-[[4-[2-(1,2,3,4-tetrahydroquinolin-7-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[4-[2-(1,2,3,4-tetrahydroquinolin-7-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 177377664 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[5-[[4-[2-(1,2,3,4-tetrahydroquinolin-7-yl)ethynyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(CN2CCC(C#Cc3ccc4c(c3)NCCC4)CC2)s1 |
| InChI | InChI=1S/C22H26N4OS/c1-16(27)25-22-24-14-20(28-22)15-26-11-8-17(9-12-26)4-5-18-6-7-19-3-2-10-23-21(19)13-18/h6-7,13-14,17,23H,2-3,8-12,15H2,1H3,(H,24,25,27) |
| InChIKey | GJVKGOTYFZOFPT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|