C23H23N5O6 — CID 177377695
4-N-hydroxy-1-N-[2-[[4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzoyl]amino]ethyl]benzene-1,4-dicarboxamide (PubChem CID 177377695) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is 4-N-hydroxy-1-N-[2-[[4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzoyl]amino]ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-hydroxy-1-N-[2-[[4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzoyl]amino]ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 177377695 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-N-hydroxy-1-N-[2-[[4-[(Z)-(1-methyl-3,6-dioxopiperazin-2-ylidene)methyl]benzoyl]amino]ethyl]benzene-1,4-dicarboxamide |
| SMILES | CN1C(=O)CNC(=O)/C1=C/c1ccc(C(=O)NCCNC(=O)c2ccc(C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C23H23N5O6/c1-28-18(23(33)26-13-19(28)29)12-14-2-4-15(5-3-14)20(30)24-10-11-25-21(31)16-6-8-17(9-7-16)22(32)27-34/h2-9,12,34H,10-11,13H2,1H3,(H,24,30)(H,25,31)(H,26,33)(H,27,32)/b18-12- |
| InChIKey | IUGUXHAVRSIWCO-PDGQHHTCSA-N |
| XLogP | -0.11 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|