C8H12O8 — CID 177377806
2-[[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl]propanedioic acid (PubChem CID 177377806) has the molecular formula C8H12O8 and a molecular weight of 236.18 g/mol. Its IUPAC name is 2-[[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl]propanedioic acid.
| Compound Name | 2-[[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 177377806 |
| Molecular Formula | C8H12O8 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-[[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl]propanedioic acid |
| SMILES | O=C(O)C(C[C@H]1OC(O)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C8H12O8/c9-4-3(16-8(15)5(4)10)1-2(6(11)12)7(13)14/h2-5,8-10,15H,1H2,(H,11,12)(H,13,14)/t3-,4-,5-,8?/m1/s1 |
| InChIKey | VJRNYXIOELZBPG-SHXFMUIJSA-N |
| XLogP | -2.40 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|