C10H19O10P — CID 177377808
2-[(3R,4S,5S)-3,4,5-trihydroxy-7-phosphonoheptan-2-yl]propanedioic acid (PubChem CID 177377808) has the molecular formula C10H19O10P and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-[(3R,4S,5S)-3,4,5-trihydroxy-7-phosphonoheptan-2-yl]propanedioic acid.
| Compound Name | 2-[(3R,4S,5S)-3,4,5-trihydroxy-7-phosphonoheptan-2-yl]propanedioic acid |
|---|---|
| PubChem CID | 177377808 |
| Molecular Formula | C10H19O10P |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[(3R,4S,5S)-3,4,5-trihydroxy-7-phosphonoheptan-2-yl]propanedioic acid |
| SMILES | CC(C(C(=O)O)C(=O)O)[C@@H](O)[C@@H](O)[C@@H](O)CCP(=O)(O)O |
| InChI | InChI=1S/C10H19O10P/c1-4(6(9(14)15)10(16)17)7(12)8(13)5(11)2-3-21(18,19)20/h4-8,11-13H,2-3H2,1H3,(H,14,15)(H,16,17)(H2,18,19,20)/t4?,5-,7+,8-/m0/s1 |
| InChIKey | PBPQQKVXKFBBKT-ADSCKCJESA-N |
| XLogP | -1.94 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|