C26H36O7 — CID 177378215
[(4aR,5S,7R,8S,8aR)-5-acetyloxy-7,8-dimethyl-4-oxo-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl (E)-2-methylbut-2-enoate (PubChem CID 177378215) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is [(4aR,5S,7R,8S,8aR)-5-acetyloxy-7,8-dimethyl-4-oxo-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [(4aR,5S,7R,8S,8aR)-5-acetyloxy-7,8-dimethyl-4-oxo-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 177378215 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [(4aR,5S,7R,8S,8aR)-5-acetyloxy-7,8-dimethyl-4-oxo-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC[C@]12C(=O)CCC[C@@H]1[C@@](C)(CCC1=CC(=O)OC1)[C@H](C)C[C@@H]2OC(C)=O |
| InChI | InChI=1S/C26H36O7/c1-6-16(2)24(30)32-15-26-20(8-7-9-21(26)28)25(5,11-10-19-13-23(29)31-14-19)17(3)12-22(26)33-18(4)27/h6,13,17,20,22H,7-12,14-15H2,1-5H3/b16-6+/t17-,20-,22+,25+,26-/m1/s1 |
| InChIKey | XBVQDBZRXLOQRK-OLXSTVHYSA-N |
| XLogP | 4.09 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|