C25H35ClO6 — CID 177378225
[(4R,4aS,7R,8S,8aR)-4-(chloromethyl)-4-hydroxy-7,8-dimethyl-5-oxo-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,3,6,7,8a-hexahydronaphthalen-4a-yl]methyl (E)-2-methylbut-2-enoate (PubChem CID 177378225) has the molecular formula C25H35ClO6 and a molecular weight of 467.00 g/mol. Its IUPAC name is [(4R,4aS,7R,8S,8aR)-4-(chloromethyl)-4-hydroxy-7,8-dimethyl-5-oxo-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,3,6,7,8a-hexahydronaphthalen-4a-yl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [(4R,4aS,7R,8S,8aR)-4-(chloromethyl)-4-hydroxy-7,8-dimethyl-5-oxo-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,3,6,7,8a-hexahydronaphthalen-4a-yl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 177378225 |
| Molecular Formula | C25H35ClO6 |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [(4R,4aS,7R,8S,8aR)-4-(chloromethyl)-4-hydroxy-7,8-dimethyl-5-oxo-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,3,6,7,8a-hexahydronaphthalen-4a-yl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC[C@@]12C(=O)C[C@@H](C)[C@](C)(CCC3=CC(=O)OC3)[C@H]1CCC[C@]2(O)CCl |
| InChI | InChI=1S/C25H35ClO6/c1-5-16(2)22(29)32-15-25-19(7-6-9-24(25,30)14-26)23(4,17(3)11-20(25)27)10-8-18-12-21(28)31-13-18/h5,12,17,19,30H,6-11,13-15H2,1-4H3/b16-5+/t17-,19-,23+,24+,25+/m1/s1 |
| InChIKey | UJLLFFUDFMVGBN-SWMUMAEJSA-N |
| XLogP | 4.13 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|