C23H23F3N3O2PS — CID 177378276
2-dipyridin-2-ylphosphoryl-2-methyl-N-[2-[2-(trifluoromethyl)phenyl]sulfanylethyl]propanamide (PubChem CID 177378276) has the molecular formula C23H23F3N3O2PS and a molecular weight of 493.49 g/mol. Its IUPAC name is 2-dipyridin-2-ylphosphoryl-2-methyl-N-[2-[2-(trifluoromethyl)phenyl]sulfanylethyl]propanamide.
| Compound Name | 2-dipyridin-2-ylphosphoryl-2-methyl-N-[2-[2-(trifluoromethyl)phenyl]sulfanylethyl]propanamide |
|---|---|
| PubChem CID | 177378276 |
| Molecular Formula | C23H23F3N3O2PS |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-dipyridin-2-ylphosphoryl-2-methyl-N-[2-[2-(trifluoromethyl)phenyl]sulfanylethyl]propanamide |
| SMILES | CC(C)(C(=O)NCCSc1ccccc1C(F)(F)F)P(=O)(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C23H23F3N3O2PS/c1-22(2,32(31,19-11-5-7-13-27-19)20-12-6-8-14-28-20)21(30)29-15-16-33-18-10-4-3-9-17(18)23(24,25)26/h3-14H,15-16H2,1-2H3,(H,29,30) |
| InChIKey | PHBUDQKEDHTXBM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|