C22H28N4O2S — CID 177378367
N',N'-diethyl-N-[2-(4-methylsulfonylphenyl)quinazolin-4-yl]propane-1,3-diamine (PubChem CID 177378367) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-(4-methylsulfonylphenyl)quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[2-(4-methylsulfonylphenyl)quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 177378367 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N',N'-diethyl-N-[2-(4-methylsulfonylphenyl)quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(-c2ccc(S(C)(=O)=O)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H28N4O2S/c1-4-26(5-2)16-8-15-23-22-19-9-6-7-10-20(19)24-21(25-22)17-11-13-18(14-12-17)29(3,27)28/h6-7,9-14H,4-5,8,15-16H2,1-3H3,(H,23,24,25) |
| InChIKey | OJQNPHDJSYUOEJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|