C37H51N5O5 — CID 177378441
benzyl N-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexyl]carbamate (PubChem CID 177378441) has the molecular formula C37H51N5O5 and a molecular weight of 645.85 g/mol. Its IUPAC name is benzyl N-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 177378441 |
| Molecular Formula | C37H51N5O5 |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.39 |
| IUPAC Name | benzyl N-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)NCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C37H51N5O5/c1-37(2,3)47-36(45)42-32(22-12-15-25-40-35(44)46-26-27-16-6-4-7-17-27)34(43)39-24-14-5-13-23-38-33-28-18-8-10-20-30(28)41-31-21-11-9-19-29(31)33/h4,6-8,10,16-18,20,32H,5,9,11-15,19,21-26H2,1-3H3,(H,38,41)(H,39,43)(H,40,44)(H,42,45)/t32-/m0/s1 |
| InChIKey | TWTLNZKCLALQCX-YTTGMZPUSA-N |
| XLogP | 6.80 |
| TPSA | 130.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|