C32H43N5O3 — CID 177378451
benzyl N-[(5S)-5-amino-6-oxo-6-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexyl]carbamate (PubChem CID 177378451) has the molecular formula C32H43N5O3 and a molecular weight of 545.73 g/mol. Its IUPAC name is benzyl N-[(5S)-5-amino-6-oxo-6-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-amino-6-oxo-6-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 177378451 |
| Molecular Formula | C32H43N5O3 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | benzyl N-[(5S)-5-amino-6-oxo-6-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexyl]carbamate |
| SMILES | N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)NCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C32H43N5O3/c33-27(17-9-12-22-36-32(39)40-23-24-13-3-1-4-14-24)31(38)35-21-11-2-10-20-34-30-25-15-5-7-18-28(25)37-29-19-8-6-16-26(29)30/h1,3-5,7,13-15,18,27H,2,6,8-12,16-17,19-23,33H2,(H,34,37)(H,35,38)(H,36,39)/t27-/m0/s1 |
| InChIKey | HFSWCDQEXDDLQY-MHZLTWQESA-N |
| XLogP | 5.24 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|