C34H46N4O4 — CID 177378459
methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylamino]hexanoate (PubChem CID 177378459) has the molecular formula C34H46N4O4 and a molecular weight of 574.77 g/mol. Its IUPAC name is methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylamino]hexanoate.
| Compound Name | methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylamino]hexanoate |
|---|---|
| PubChem CID | 177378459 |
| Molecular Formula | C34H46N4O4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C34H46N4O4/c1-41-33(39)31(21-11-14-24-37-34(40)42-25-26-15-5-4-6-16-26)35-22-12-2-3-13-23-36-32-27-17-7-9-19-29(27)38-30-20-10-8-18-28(30)32/h4-7,9,15-17,19,31,35H,2-3,8,10-14,18,20-25H2,1H3,(H,36,38)(H,37,40)/t31-/m0/s1 |
| InChIKey | BFRKFHUISFQHGV-HKBQPEDESA-N |
| XLogP | 6.31 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|