C27H23N3O4 — CID 177378480
methyl (2R)-2-[[2-[(2-hydroxynaphthalen-1-yl)diazenyl]benzoyl]amino]-3-phenylpropanoate (PubChem CID 177378480) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is methyl (2R)-2-[[2-[(2-hydroxynaphthalen-1-yl)diazenyl]benzoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[2-[(2-hydroxynaphthalen-1-yl)diazenyl]benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 177378480 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | methyl (2R)-2-[[2-[(2-hydroxynaphthalen-1-yl)diazenyl]benzoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1/N=N/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C27H23N3O4/c1-34-27(33)23(17-18-9-3-2-4-10-18)28-26(32)21-13-7-8-14-22(21)29-30-25-20-12-6-5-11-19(20)15-16-24(25)31/h2-16,23,31H,17H2,1H3,(H,28,32)/b30-29+/t23-/m1/s1 |
| InChIKey | BWUQVNFYRILALP-QZSABBLZSA-N |
| XLogP | 5.47 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|