C25H25Cl2FN6O — CID 177378535
4-[(2,6-dichloro-3-fluorophenyl)methoxymethyl]-12-(1-piperidin-4-ylpyrazol-4-yl)-8,9,11-triazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene (PubChem CID 177378535) has the molecular formula C25H25Cl2FN6O and a molecular weight of 515.42 g/mol. Its IUPAC name is 4-[(2,6-dichloro-3-fluorophenyl)methoxymethyl]-12-(1-piperidin-4-ylpyrazol-4-yl)-8,9,11-triazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene.
| Compound Name | 4-[(2,6-dichloro-3-fluorophenyl)methoxymethyl]-12-(1-piperidin-4-ylpyrazol-4-yl)-8,9,11-triazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene |
|---|---|
| PubChem CID | 177378535 |
| Molecular Formula | C25H25Cl2FN6O |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 4-[(2,6-dichloro-3-fluorophenyl)methoxymethyl]-12-(1-piperidin-4-ylpyrazol-4-yl)-8,9,11-triazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene |
| SMILES | Fc1ccc(Cl)c(COCC2Cc3cn4ncnc(-c5cnn(C6CCNCC6)c5)c4c3C2)c1Cl |
| InChI | InChI=1S/C25H25Cl2FN6O/c26-21-1-2-22(28)23(27)20(21)13-35-12-15-7-16-10-34-25(19(16)8-15)24(30-14-32-34)17-9-31-33(11-17)18-3-5-29-6-4-18/h1-2,9-11,14-15,18,29H,3-8,12-13H2 |
| InChIKey | IWWKFNUCZJIMLN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|