About S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate
S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate (PubChem CID 177378560) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate.
Molecular Properties
| Compound Name | S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate |
| PubChem CID | 177378560 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate |
| SMILES | CCCCSC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C9H15NO3S/c1-2-3-6-14-9(12)10-7-4-5-13-8(7)11/h7H,2-6H2,1H3,(H,10,12)/t7-/m0/s1 |
| InChIKey | QODQGGFSPGJRAI-ZETCQYMHSA-N |
| XLogP | 1.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate?
The IUPAC name of S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate (CID 177378560) is S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate.
What is the SMILES notation for S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate?
The canonical SMILES for S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate is CCCCSC(=O)N[C@H]1CCOC1=O.
What is the InChIKey of S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate?
The InChIKey is QODQGGFSPGJRAI-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H15NO3S/c1-2-3-6-14-9(12)10-7-4-5-13-8(7)11/h7H,2-6H2,1H3,(H,10,12)/t7-/m0/s1.
What are the key properties of S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate?
S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate has a molecular weight of 217.29 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-butyl N-[(3S)-2-oxooxolan-3-yl]carbamothioate is sourced from PubChem (CID 177378560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).