C22H21ClFN3O3S — CID 177378682
1-(3-chlorophenyl)sulfonyl-2-(3-fluorophenyl)-N-piperidin-4-ylpyrrole-3-carboxamide (PubChem CID 177378682) has the molecular formula C22H21ClFN3O3S and a molecular weight of 461.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-2-(3-fluorophenyl)-N-piperidin-4-ylpyrrole-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-2-(3-fluorophenyl)-N-piperidin-4-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 177378682 |
| Molecular Formula | C22H21ClFN3O3S |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-2-(3-fluorophenyl)-N-piperidin-4-ylpyrrole-3-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1ccn(S(=O)(=O)c2cccc(Cl)c2)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H21ClFN3O3S/c23-16-4-2-6-19(14-16)31(29,30)27-12-9-20(21(27)15-3-1-5-17(24)13-15)22(28)26-18-7-10-25-11-8-18/h1-6,9,12-14,18,25H,7-8,10-11H2,(H,26,28) |
| InChIKey | KEDXCWCMWDUDDF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |