About (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine
(2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine (PubChem CID 177378706) has the molecular formula C24H27NO3
and a molecular weight of 377.48 g/mol. Its IUPAC name is (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine.
Molecular Properties
| Compound Name | (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine |
| PubChem CID | 177378706 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine |
| SMILES | COc1ccc(OC[C@H]2CCCN2Cc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C24H27NO3/c1-26-23-13-12-21(15-24(23)27-2)28-17-20-10-6-14-25(20)16-19-9-5-8-18-7-3-4-11-22(18)19/h3-5,7-9,11-13,15,20H,6,10,14,16-17H2,1-2H3/t20-/m1/s1 |
| InChIKey | YWFPWJALPXIKNX-HXUWFJFHSA-N |
| XLogP | 4.90 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine?
The IUPAC name of (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine (CID 177378706) is (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine.
What is the SMILES notation for (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine?
The canonical SMILES for (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine is COc1ccc(OC[C@H]2CCCN2Cc2cccc3ccccc23)cc1OC.
What is the InChIKey of (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine?
The InChIKey is YWFPWJALPXIKNX-HXUWFJFHSA-N. The full InChI is InChI=1S/C24H27NO3/c1-26-23-13-12-21(15-24(23)27-2)28-17-20-10-6-14-25(20)16-19-9-5-8-18-7-3-4-11-22(18)19/h3-5,7-9,11-13,15,20H,6,10,14,16-17H2,1-2H3/t20-/m1/s1.
What are the key properties of (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine?
(2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine has a molecular weight of 377.48 g/mol, XLogP of 4.90, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3,4-dimethoxyphenoxy)methyl]-1-(naphthalen-1-ylmethyl)pyrrolidine is sourced from PubChem (CID 177378706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).