C41H42ClN3O4 — CID 177378795
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-(indol-1-ylmethyl)phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid (PubChem CID 177378795) has the molecular formula C41H42ClN3O4 and a molecular weight of 676.26 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-(indol-1-ylmethyl)phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-(indol-1-ylmethyl)phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 177378795 |
| Molecular Formula | C41H42ClN3O4 |
| Molecular Weight | 676.26 g/mol |
| Exact Mass | 675.29 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-(indol-1-ylmethyl)phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)n(CCN3CCOCC3)c3c(-c4ccccc4Cn4ccc5ccccc54)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C41H42ClN3O4/c1-28-25-32(26-29(2)38(28)42)49-22-8-14-36-35-13-7-12-34(39(35)45(40(36)41(46)47)19-18-43-20-23-48-24-21-43)33-11-5-3-10-31(33)27-44-17-16-30-9-4-6-15-37(30)44/h3-7,9-13,15-17,25-26H,8,14,18-24,27H2,1-2H3,(H,46,47) |
| InChIKey | WROHTTVJSHLXGG-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.26 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|