C42H44ClN3O4 — CID 177378798
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[(5-methylindol-1-yl)methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid (PubChem CID 177378798) has the molecular formula C42H44ClN3O4 and a molecular weight of 690.28 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[(5-methylindol-1-yl)methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[(5-methylindol-1-yl)methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 177378798 |
| Molecular Formula | C42H44ClN3O4 |
| Molecular Weight | 690.28 g/mol |
| Exact Mass | 689.30 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[(5-methylindol-1-yl)methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
| SMILES | Cc1ccc2c(ccn2Cc2ccccc2-c2cccc3c(CCCOc4cc(C)c(Cl)c(C)c4)c(C(=O)O)n(CCN4CCOCC4)c23)c1 |
| InChI | InChI=1S/C42H44ClN3O4/c1-28-13-14-38-31(24-28)15-16-45(38)27-32-8-4-5-9-34(32)35-10-6-11-36-37(12-7-21-50-33-25-29(2)39(43)30(3)26-33)41(42(47)48)46(40(35)36)18-17-44-19-22-49-23-20-44/h4-6,8-11,13-16,24-26H,7,12,17-23,27H2,1-3H3,(H,47,48) |
| InChIKey | NJFNJZNTBKJMDY-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.28 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|