C42H44ClN3O5 — CID 177378800
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[(5-methoxyindol-1-yl)methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid (PubChem CID 177378800) has the molecular formula C42H44ClN3O5 and a molecular weight of 706.28 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[(5-methoxyindol-1-yl)methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[(5-methoxyindol-1-yl)methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 177378800 |
| Molecular Formula | C42H44ClN3O5 |
| Molecular Weight | 706.28 g/mol |
| Exact Mass | 705.30 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[(5-methoxyindol-1-yl)methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
| SMILES | COc1ccc2c(ccn2Cc2ccccc2-c2cccc3c(CCCOc4cc(C)c(Cl)c(C)c4)c(C(=O)O)n(CCN4CCOCC4)c23)c1 |
| InChI | InChI=1S/C42H44ClN3O5/c1-28-24-33(25-29(2)39(28)43)51-21-7-12-37-36-11-6-10-35(40(36)46(41(37)42(47)48)18-17-44-19-22-50-23-20-44)34-9-5-4-8-31(34)27-45-16-15-30-26-32(49-3)13-14-38(30)45/h4-6,8-11,13-16,24-26H,7,12,17-23,27H2,1-3H3,(H,47,48) |
| InChIKey | CQWZKCYTJREQLW-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.28 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|