C46H49ClN4O5 — CID 177378804
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(2-morpholin-4-ylethyl)-7-[2-[[3-[2-(prop-2-enoylamino)ethyl]indol-1-yl]methyl]phenyl]indole-2-carboxylic acid (PubChem CID 177378804) has the molecular formula C46H49ClN4O5 and a molecular weight of 773.37 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(2-morpholin-4-ylethyl)-7-[2-[[3-[2-(prop-2-enoylamino)ethyl]indol-1-yl]methyl]phenyl]indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(2-morpholin-4-ylethyl)-7-[2-[[3-[2-(prop-2-enoylamino)ethyl]indol-1-yl]methyl]phenyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 177378804 |
| Molecular Formula | C46H49ClN4O5 |
| Molecular Weight | 773.37 g/mol |
| Exact Mass | 772.34 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(2-morpholin-4-ylethyl)-7-[2-[[3-[2-(prop-2-enoylamino)ethyl]indol-1-yl]methyl]phenyl]indole-2-carboxylic acid |
| SMILES | C=CC(=O)NCCc1cn(Cc2ccccc2-c2cccc3c(CCCOc4cc(C)c(Cl)c(C)c4)c(C(=O)O)n(CCN4CCOCC4)c23)c2ccccc12 |
| InChI | InChI=1S/C46H49ClN4O5/c1-4-42(52)48-19-18-34-30-50(41-17-8-7-13-37(34)41)29-33-11-5-6-12-36(33)38-14-9-15-39-40(16-10-24-56-35-27-31(2)43(47)32(3)28-35)45(46(53)54)51(44(38)39)21-20-49-22-25-55-26-23-49/h4-9,11-15,17,27-28,30H,1,10,16,18-26,29H2,2-3H3,(H,48,52)(H,53,54) |
| InChIKey | UJUBUDLQXUGOAZ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.37 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|