C50H50Cl2N4O5 — CID 177378806
7-[2-[[3-[2-[(4-chlorobenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid (PubChem CID 177378806) has the molecular formula C50H50Cl2N4O5 and a molecular weight of 857.88 g/mol. Its IUPAC name is 7-[2-[[3-[2-[(4-chlorobenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid.
| Compound Name | 7-[2-[[3-[2-[(4-chlorobenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 177378806 |
| Molecular Formula | C50H50Cl2N4O5 |
| Molecular Weight | 857.88 g/mol |
| Exact Mass | 856.32 |
| IUPAC Name | 7-[2-[[3-[2-[(4-chlorobenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)n(CCN3CCOCC3)c3c(-c4ccccc4Cn4cc(CCNC(=O)c5ccc(Cl)cc5)c5ccccc54)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C50H50Cl2N4O5/c1-33-29-39(30-34(2)46(33)52)61-26-8-14-44-43-13-7-12-42(47(43)56(48(44)50(58)59)23-22-54-24-27-60-28-25-54)40-10-4-3-9-36(40)31-55-32-37(41-11-5-6-15-45(41)55)20-21-53-49(57)35-16-18-38(51)19-17-35/h3-7,9-13,15-19,29-30,32H,8,14,20-28,31H2,1-2H3,(H,53,57)(H,58,59) |
| InChIKey | UGGNTHQCPUHUNQ-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.88 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|