C51H51ClN4O6 — CID 177378811
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[[3-[2-[(4-formylbenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid (PubChem CID 177378811) has the molecular formula C51H51ClN4O6 and a molecular weight of 851.44 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[[3-[2-[(4-formylbenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[[3-[2-[(4-formylbenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 177378811 |
| Molecular Formula | C51H51ClN4O6 |
| Molecular Weight | 851.44 g/mol |
| Exact Mass | 850.35 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[[3-[2-[(4-formylbenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)n(CCN3CCOCC3)c3c(-c4ccccc4Cn4cc(CCNC(=O)c5ccc(C=O)cc5)c5ccccc54)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C51H51ClN4O6/c1-34-29-40(30-35(2)47(34)52)62-26-8-14-45-44-13-7-12-43(48(44)56(49(45)51(59)60)23-22-54-24-27-61-28-25-54)41-10-4-3-9-38(41)31-55-32-39(42-11-5-6-15-46(42)55)20-21-53-50(58)37-18-16-36(33-57)17-19-37/h3-7,9-13,15-19,29-30,32-33H,8,14,20-28,31H2,1-2H3,(H,53,58)(H,59,60) |
| InChIKey | HZWDBANRRANWBB-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.44 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|