C51H53ClN4O5 — CID 177378814
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[[3-[2-[(2-methylbenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid (PubChem CID 177378814) has the molecular formula C51H53ClN4O5 and a molecular weight of 837.46 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[[3-[2-[(2-methylbenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[[3-[2-[(2-methylbenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 177378814 |
| Molecular Formula | C51H53ClN4O5 |
| Molecular Weight | 837.46 g/mol |
| Exact Mass | 836.37 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[2-[[3-[2-[(2-methylbenzoyl)amino]ethyl]indol-1-yl]methyl]phenyl]-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
| SMILES | Cc1ccccc1C(=O)NCCc1cn(Cc2ccccc2-c2cccc3c(CCCOc4cc(C)c(Cl)c(C)c4)c(C(=O)O)n(CCN4CCOCC4)c23)c2ccccc12 |
| InChI | InChI=1S/C51H53ClN4O5/c1-34-12-4-6-14-40(34)50(57)53-22-21-38-33-55(46-20-9-8-16-42(38)46)32-37-13-5-7-15-41(37)43-17-10-18-44-45(19-11-27-61-39-30-35(2)47(52)36(3)31-39)49(51(58)59)56(48(43)44)24-23-54-25-28-60-29-26-54/h4-10,12-18,20,30-31,33H,11,19,21-29,32H2,1-3H3,(H,53,57)(H,58,59) |
| InChIKey | BYRVXMIHRJFKID-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.46 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|