C30H24N2O5S — CID 177378928
dibenzyl (1R,2R,5R)-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate (PubChem CID 177378928) has the molecular formula C30H24N2O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is dibenzyl (1R,2R,5R)-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate.
| Compound Name | dibenzyl (1R,2R,5R)-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 177378928 |
| Molecular Formula | C30H24N2O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | dibenzyl (1R,2R,5R)-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1C[C@@H](N=C=S)C=C[C@@]12C(=O)N(C(=O)OCc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C30H24N2O5S/c33-27(36-18-21-9-3-1-4-10-21)25-17-23(31-20-38)15-16-30(25)24-13-7-8-14-26(24)32(28(30)34)29(35)37-19-22-11-5-2-6-12-22/h1-16,23,25H,17-19H2/t23-,25-,30-/m0/s1 |
| InChIKey | FGINEIWOBPOXNL-VQGKEWTASA-N |
| XLogP | 5.40 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|